C12H14N2 — CID 155261407
4-(5-aminocyclohexa-1,5-dien-1-yl)aniline (PubChem CID 155261407) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-(5-aminocyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 4-(5-aminocyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 155261407 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-(5-aminocyclohexa-1,5-dien-1-yl)aniline |
| SMILES | NC1=CC(c2ccc(N)cc2)=CCC1 |
| InChI | InChI=1S/C12H14N2/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h2,4-8H,1,3,13-14H2 |
| InChIKey | YKVJPWLICOFGMP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|