C30H26N2 — CID 167515698
3-N,3-N-bis(4-phenylphenyl)cyclohexa-1,3-diene-1,3-diamine (PubChem CID 167515698) has the molecular formula C30H26N2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-N,3-N-bis(4-phenylphenyl)cyclohexa-1,3-diene-1,3-diamine.
| Compound Name | 3-N,3-N-bis(4-phenylphenyl)cyclohexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 167515698 |
| Molecular Formula | C30H26N2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-N,3-N-bis(4-phenylphenyl)cyclohexa-1,3-diene-1,3-diamine |
| SMILES | NC1=CC(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)=CCC1 |
| InChI | InChI=1S/C30H26N2/c31-27-12-7-13-30(22-27)32(28-18-14-25(15-19-28)23-8-3-1-4-9-23)29-20-16-26(17-21-29)24-10-5-2-6-11-24/h1-6,8-11,13-22H,7,12,31H2 |
| InChIKey | JIUUERKBZKACMT-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |