About cyclohexa-2,6-diene-1,2-diamine;ethane
cyclohexa-2,6-diene-1,2-diamine;ethane (PubChem CID 143733519) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is cyclohexa-2,6-diene-1,2-diamine;ethane.
Molecular Properties
| Compound Name | cyclohexa-2,6-diene-1,2-diamine;ethane |
| PubChem CID | 143733519 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | cyclohexa-2,6-diene-1,2-diamine;ethane |
| SMILES | CC.NC1=CCCC=C1N |
| InChI | InChI=1S/C6H10N2.C2H6/c7-5-3-1-2-4-6(5)8;1-2/h3-4H,1-2,7-8H2;1-2H3 |
| InChIKey | IAMRGBUVFSNHEZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-2,6-diene-1,2-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,6-diene-1,2-diamine;ethane?
The IUPAC name of cyclohexa-2,6-diene-1,2-diamine;ethane (CID 143733519) is cyclohexa-2,6-diene-1,2-diamine;ethane.
What is the SMILES notation for cyclohexa-2,6-diene-1,2-diamine;ethane?
The canonical SMILES for cyclohexa-2,6-diene-1,2-diamine;ethane is CC.NC1=CCCC=C1N.
What is the InChIKey of cyclohexa-2,6-diene-1,2-diamine;ethane?
The InChIKey is IAMRGBUVFSNHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H6/c7-5-3-1-2-4-6(5)8;1-2/h3-4H,1-2,7-8H2;1-2H3.
What are the key properties of cyclohexa-2,6-diene-1,2-diamine;ethane?
cyclohexa-2,6-diene-1,2-diamine;ethane has a molecular weight of 140.23 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,6-diene-1,2-diamine;ethane is sourced from PubChem (CID 143733519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).