C7H10N2 — CID 142103720
6-methanimidoylcyclohexa-1,5-dien-1-amine (PubChem CID 142103720) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 6-methanimidoylcyclohexa-1,5-dien-1-amine.
| Compound Name | 6-methanimidoylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 142103720 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 6-methanimidoylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/C1=CCCC=C1N |
| InChI | InChI=1S/C7H10N2/c8-5-6-3-1-2-4-7(6)9/h3-5,8H,1-2,9H2/b8-5+ |
| InChIKey | MMHKDWPQPWWMBQ-VMPITWQZSA-N |
| XLogP | 1.20 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|