C7H8N4 — CID 119083669
2,6-dimethanimidoylpyridin-4-amine (PubChem CID 119083669) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 2,6-dimethanimidoylpyridin-4-amine.
| Compound Name | 2,6-dimethanimidoylpyridin-4-amine |
|---|---|
| PubChem CID | 119083669 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2,6-dimethanimidoylpyridin-4-amine |
| SMILES | [H]/N=C/c1cc(N)cc(/C=N/[H])n1 |
| InChI | InChI=1S/C7H8N4/c8-3-6-1-5(10)2-7(4-9)11-6/h1-4,8-9H,(H2,10,11)/b8-3+,9-4+ |
| InChIKey | GNBOLCMEKJCYED-BQYBEJQRSA-N |
| XLogP | 0.66 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|