About ethane;2-methanimidoylbenzene-1,4-diamine
ethane;2-methanimidoylbenzene-1,4-diamine (PubChem CID 143170721) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;2-methanimidoylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | ethane;2-methanimidoylbenzene-1,4-diamine |
| PubChem CID | 143170721 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;2-methanimidoylbenzene-1,4-diamine |
| SMILES | CC.[H]/N=C/c1cc(N)ccc1N |
| InChI | InChI=1S/C7H9N3.C2H6/c8-4-5-3-6(9)1-2-7(5)10;1-2/h1-4,8H,9-10H2;1-2H3/b8-4+; |
| InChIKey | LZQSKBYMDQPMQS-ZFXMFRGYSA-N |
| XLogP | 1.87 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methanimidoylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methanimidoylbenzene-1,4-diamine?
The IUPAC name of ethane;2-methanimidoylbenzene-1,4-diamine (CID 143170721) is ethane;2-methanimidoylbenzene-1,4-diamine.
What is the SMILES notation for ethane;2-methanimidoylbenzene-1,4-diamine?
The canonical SMILES for ethane;2-methanimidoylbenzene-1,4-diamine is CC.[H]/N=C/c1cc(N)ccc1N.
What is the InChIKey of ethane;2-methanimidoylbenzene-1,4-diamine?
The InChIKey is LZQSKBYMDQPMQS-ZFXMFRGYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c8-4-5-3-6(9)1-2-7(5)10;1-2/h1-4,8H,9-10H2;1-2H3/b8-4+;.
What are the key properties of ethane;2-methanimidoylbenzene-1,4-diamine?
ethane;2-methanimidoylbenzene-1,4-diamine has a molecular weight of 165.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methanimidoylbenzene-1,4-diamine is sourced from PubChem (CID 143170721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).