C9H15N3 — CID 143170721
ethane;2-methanimidoylbenzene-1,4-diamine (PubChem CID 143170721) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;2-methanimidoylbenzene-1,4-diamine.
| Compound Name | ethane;2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143170721 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;2-methanimidoylbenzene-1,4-diamine |
| SMILES | CC.[H]/N=C/c1cc(N)ccc1N |
| InChI | InChI=1S/C7H9N3.C2H6/c8-4-5-3-6(9)1-2-7(5)10;1-2/h1-4,8H,9-10H2;1-2H3/b8-4+; |
| InChIKey | LZQSKBYMDQPMQS-ZFXMFRGYSA-N |
| XLogP | 1.87 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|