C9H13N — CID 163245070
(2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 163245070) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 163245070 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1=C(C)CCC=C1C |
| InChI | InChI=1S/C9H13N/c1-7-4-3-5-8(2)9(7)6-10/h4,6,10H,3,5H2,1-2H3/b10-6+ |
| InChIKey | GSDJPGLDQZOWLG-UXBLZVDNSA-N |
| XLogP | 2.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|