C14H25N — CID 163245069
(2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine;ethane;prop-1-ene (PubChem CID 163245069) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine;ethane;prop-1-ene.
| Compound Name | (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 163245069 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (2,6-dimethylcyclohexa-1,5-dien-1-yl)methanimine;ethane;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=C/C1=C(C)CCC=C1C |
| InChI | InChI=1S/C9H13N.C3H6.C2H6/c1-7-4-3-5-8(2)9(7)6-10;1-3-2;1-2/h4,6,10H,3,5H2,1-2H3;3H,1H2,2H3;1-2H3/b10-6+;; |
| InChIKey | FQFDFVJQDWYBAQ-DOLBFOAYSA-N |
| XLogP | 4.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|