C10H14N2 — CID 171629333
(5-ethenyl-1,6-dimethyl-2H-pyridin-4-yl)methanimine (PubChem CID 171629333) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (5-ethenyl-1,6-dimethyl-2H-pyridin-4-yl)methanimine.
| Compound Name | (5-ethenyl-1,6-dimethyl-2H-pyridin-4-yl)methanimine |
|---|---|
| PubChem CID | 171629333 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (5-ethenyl-1,6-dimethyl-2H-pyridin-4-yl)methanimine |
| SMILES | [H]/N=C/C1=CCN(C)C(C)=C1C=C |
| InChI | InChI=1S/C10H14N2/c1-4-10-8(2)12(3)6-5-9(10)7-11/h4-5,7,11H,1,6H2,2-3H3/b11-7+ |
| InChIKey | RDYKZAHGZHFUCJ-YRNVUSSQSA-N |
| XLogP | 1.97 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|