C7H8N2O — CID 144576255
4-ethenyl-3-methanimidoyl-1,2-dihydropyrrol-5-one (PubChem CID 144576255) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 4-ethenyl-3-methanimidoyl-1,2-dihydropyrrol-5-one.
| Compound Name | 4-ethenyl-3-methanimidoyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 144576255 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 4-ethenyl-3-methanimidoyl-1,2-dihydropyrrol-5-one |
| SMILES | [H]/N=C/C1=C(C=C)C(=O)NC1 |
| InChI | InChI=1S/C7H8N2O/c1-2-6-5(3-8)4-9-7(6)10/h2-3,8H,1,4H2,(H,9,10)/b8-3+ |
| InChIKey | QPFALEKYYZYZQO-FPYGCLRLSA-N |
| XLogP | 0.25 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|