C9H15N3O2 — CID 155579582
4-amino-5-methanimidoyl-3H-pyridine-2,6-dione;propane (PubChem CID 155579582) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-amino-5-methanimidoyl-3H-pyridine-2,6-dione;propane.
| Compound Name | 4-amino-5-methanimidoyl-3H-pyridine-2,6-dione;propane |
|---|---|
| PubChem CID | 155579582 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-amino-5-methanimidoyl-3H-pyridine-2,6-dione;propane |
| SMILES | CCC.[H]/N=C/C1=C(N)CC(=O)NC1=O |
| InChI | InChI=1S/C6H7N3O2.C3H8/c7-2-3-4(8)1-5(10)9-6(3)11;1-3-2/h2,7H,1,8H2,(H,9,10,11);3H2,1-2H3/b7-2+; |
| InChIKey | WKYIYOBTNWHNNQ-NIBQXPITSA-N |
| XLogP | 0.31 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|