C9H7FN2O2 — CID 164939912
8-amino-6-fluoro-4H-isoquinoline-1,3-dione (PubChem CID 164939912) has the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. Its IUPAC name is 8-amino-6-fluoro-4H-isoquinoline-1,3-dione.
| Compound Name | 8-amino-6-fluoro-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 164939912 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 8-amino-6-fluoro-4H-isoquinoline-1,3-dione |
| SMILES | Nc1cc(F)cc2c1C(=O)NC(=O)C2 |
| InChI | InChI=1S/C9H7FN2O2/c10-5-1-4-2-7(13)12-9(14)8(4)6(11)3-5/h1,3H,2,11H2,(H,12,13,14) |
| InChIKey | MEGOHRJRTDAHJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|