C13H16FN3O — CID 117376008
5-fluoro-7-(piperazin-1-ylmethyl)-1,3-dihydroindol-2-one (PubChem CID 117376008) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 5-fluoro-7-(piperazin-1-ylmethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-7-(piperazin-1-ylmethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117376008 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 5-fluoro-7-(piperazin-1-ylmethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(F)cc(CN3CCNCC3)c2N1 |
| InChI | InChI=1S/C13H16FN3O/c14-11-5-9-7-12(18)16-13(9)10(6-11)8-17-3-1-15-2-4-17/h5-6,15H,1-4,7-8H2,(H,16,18) |
| InChIKey | ZMFJAHAMFGEQAH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |