C9H9FN2O — CID 69465620
5-amino-7-(fluoromethyl)-1,3-dihydroindol-2-one (PubChem CID 69465620) has the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. Its IUPAC name is 5-amino-7-(fluoromethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-7-(fluoromethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 69465620 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 5-amino-7-(fluoromethyl)-1,3-dihydroindol-2-one |
| SMILES | Nc1cc(CF)c2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C9H9FN2O/c10-4-6-2-7(11)1-5-3-8(13)12-9(5)6/h1-2H,3-4,11H2,(H,12,13) |
| InChIKey | UBANLBQQMJXPDG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|