C11H8FN3O2 — CID 117337397
7-(5-amino-1,2-oxazol-3-yl)-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 117337397) has the molecular formula C11H8FN3O2 and a molecular weight of 233.20 g/mol. Its IUPAC name is 7-(5-amino-1,2-oxazol-3-yl)-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 7-(5-amino-1,2-oxazol-3-yl)-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117337397 |
| Molecular Formula | C11H8FN3O2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 7-(5-amino-1,2-oxazol-3-yl)-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | Nc1cc(-c2cc(F)cc3c2NC(=O)C3)no1 |
| InChI | InChI=1S/C11H8FN3O2/c12-6-1-5-2-10(16)14-11(5)7(3-6)8-4-9(13)17-15-8/h1,3-4H,2,13H2,(H,14,16) |
| InChIKey | IBZYQOSPTPYRKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |