C11H17NO2 — CID 141176728
3-heptylidenepyrrolidine-2,5-dione (PubChem CID 141176728) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-heptylidenepyrrolidine-2,5-dione.
| Compound Name | 3-heptylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141176728 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-heptylidenepyrrolidine-2,5-dione |
| SMILES | CCCCCCC=C1CC(=O)NC1=O |
| InChI | InChI=1S/C11H17NO2/c1-2-3-4-5-6-7-9-8-10(13)12-11(9)14/h7H,2-6,8H2,1H3,(H,12,13,14) |
| InChIKey | CSRAYDQIEIMGMK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|