C10H15NO2 — CID 123499320
(3Z)-3-pentylidenepiperidine-2,6-dione (PubChem CID 123499320) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3Z)-3-pentylidenepiperidine-2,6-dione.
| Compound Name | (3Z)-3-pentylidenepiperidine-2,6-dione |
|---|---|
| PubChem CID | 123499320 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3Z)-3-pentylidenepiperidine-2,6-dione |
| SMILES | CCCC/C=C1/CCC(=O)NC1=O |
| InChI | InChI=1S/C10H15NO2/c1-2-3-4-5-8-6-7-9(12)11-10(8)13/h5H,2-4,6-7H2,1H3,(H,11,12,13)/b8-5- |
| InChIKey | XCRNVAJICUEHHH-YVMONPNESA-N |
| XLogP | 1.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|