C12H19NO2 — CID 151725018
3-hexylideneazepane-2,7-dione (PubChem CID 151725018) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-hexylideneazepane-2,7-dione.
| Compound Name | 3-hexylideneazepane-2,7-dione |
|---|---|
| PubChem CID | 151725018 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-hexylideneazepane-2,7-dione |
| SMILES | CCCCCC=C1CCCC(=O)NC1=O |
| InChI | InChI=1S/C12H19NO2/c1-2-3-4-5-7-10-8-6-9-11(14)13-12(10)15/h7H,2-6,8-9H2,1H3,(H,13,14,15) |
| InChIKey | RJJYBRUAXWXBTN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|