C11H13N — CID 142023097
(2-ethenyl-4,6-dimethylphenyl)methanimine (PubChem CID 142023097) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is (2-ethenyl-4,6-dimethylphenyl)methanimine.
| Compound Name | (2-ethenyl-4,6-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 142023097 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (2-ethenyl-4,6-dimethylphenyl)methanimine |
| SMILES | [H]/N=C/c1c(C)cc(C)cc1C=C |
| InChI | InChI=1S/C11H13N/c1-4-10-6-8(2)5-9(3)11(10)7-12/h4-7,12H,1H2,2-3H3/b12-7+ |
| InChIKey | WNOJSSNGZHVZSD-KPKJPENVSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|