C10H13NO — CID 176965340
(2-methoxy-3,5-dimethylphenyl)methanimine (PubChem CID 176965340) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2-methoxy-3,5-dimethylphenyl)methanimine.
| Compound Name | (2-methoxy-3,5-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 176965340 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2-methoxy-3,5-dimethylphenyl)methanimine |
| SMILES | [H]/N=C/c1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C10H13NO/c1-7-4-8(2)10(12-3)9(5-7)6-11/h4-6,11H,1-3H3/b11-6+ |
| InChIKey | RYFBHOYSFIMULC-IZZDOVSWSA-N |
| XLogP | 2.31 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|