About 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl
2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl (PubChem CID 164573873) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl.
Molecular Properties
| Compound Name | 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl |
| PubChem CID | 164573873 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl |
| SMILES | N=O.[H]/N=C/c1cc(C)cc(SC)c1N |
| InChI | InChI=1S/C9H12N2S.HNO/c1-6-3-7(5-10)9(11)8(4-6)12-2;1-2/h3-5,10H,11H2,1-2H3;1H/b10-5+; |
| InChIKey | FPZLOBJLSBZWNS-OAZHBLANSA-N |
| XLogP | 2.63 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl?
The IUPAC name of 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl (CID 164573873) is 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl.
What is the SMILES notation for 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl?
The canonical SMILES for 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl is N=O.[H]/N=C/c1cc(C)cc(SC)c1N.
What is the InChIKey of 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl?
The InChIKey is FPZLOBJLSBZWNS-OAZHBLANSA-N. The full InChI is InChI=1S/C9H12N2S.HNO/c1-6-3-7(5-10)9(11)8(4-6)12-2;1-2/h3-5,10H,11H2,1-2H3;1H/b10-5+;.
What are the key properties of 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl?
2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl has a molecular weight of 211.29 g/mol, XLogP of 2.63, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoyl-4-methyl-6-methylsulfanylaniline;nitroxyl is sourced from PubChem (CID 164573873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).