C10H13N — CID 144659223
(Z)-3-(2-methylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine (PubChem CID 144659223) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (Z)-3-(2-methylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine.
| Compound Name | (Z)-3-(2-methylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 144659223 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (Z)-3-(2-methylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
| SMILES | [H]/N=C/C=C\C1=C(C)CCC=C1 |
| InChI | InChI=1S/C10H13N/c1-9-5-2-3-6-10(9)7-4-8-11/h3-4,6-8,11H,2,5H2,1H3/b7-4-,11-8+ |
| InChIKey | ATTYRNJACWMROM-AFDHTILLSA-N |
| XLogP | 2.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|