About 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine
2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine (PubChem CID 144754678) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine |
| PubChem CID | 144754678 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine |
| SMILES | C1=CCOC1.[H]/N=C/C=C\c1ccccc1 |
| InChI | InChI=1S/C9H9N.C4H6O/c10-8-4-7-9-5-2-1-3-6-9;1-2-4-5-3-1/h1-8,10H;1-2H,3-4H2/b7-4-,10-8+; |
| InChIKey | PMUFJRQQRMEGHQ-UWCUUEILSA-N |
| XLogP | 2.92 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine?
The IUPAC name of 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine (CID 144754678) is 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine.
What is the SMILES notation for 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine?
The canonical SMILES for 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine is C1=CCOC1.[H]/N=C/C=C\c1ccccc1.
What is the InChIKey of 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine?
The InChIKey is PMUFJRQQRMEGHQ-UWCUUEILSA-N. The full InChI is InChI=1S/C9H9N.C4H6O/c10-8-4-7-9-5-2-1-3-6-9;1-2-4-5-3-1/h1-8,10H;1-2H,3-4H2/b7-4-,10-8+;.
What are the key properties of 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine?
2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine has a molecular weight of 201.27 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydrofuran;(Z)-3-phenylprop-2-en-1-imine is sourced from PubChem (CID 144754678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).