C7H10BNO2 — CID 163757508
(Z)-3-(2,5-dimethyl-1,3,2-dioxaborol-4-yl)prop-2-en-1-imine (PubChem CID 163757508) has the molecular formula C7H10BNO2 and a molecular weight of 150.97 g/mol. Its IUPAC name is (Z)-3-(2,5-dimethyl-1,3,2-dioxaborol-4-yl)prop-2-en-1-imine.
| Compound Name | (Z)-3-(2,5-dimethyl-1,3,2-dioxaborol-4-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 163757508 |
| Molecular Formula | C7H10BNO2 |
| Molecular Weight | 150.97 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (Z)-3-(2,5-dimethyl-1,3,2-dioxaborol-4-yl)prop-2-en-1-imine |
| SMILES | [H]/N=C/C=C\C1=C(C)OB(C)O1 |
| InChI | InChI=1S/C7H10BNO2/c1-6-7(4-3-5-9)11-8(2)10-6/h3-5,9H,1-2H3/b4-3-,9-5+ |
| InChIKey | LVIUPLVWIYVYIY-XBURUKCPSA-N |
| XLogP | 1.59 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.97 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|