About 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene
1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene (PubChem CID 54482640) has the molecular formula C17H12Br4O2
and a molecular weight of 567.90 g/mol. Its IUPAC name is 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene.
Molecular Properties
| Compound Name | 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene |
| PubChem CID | 54482640 |
| Molecular Formula | C17H12Br4O2 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 563.76 |
| IUPAC Name | 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene |
| SMILES | Brc1cccc(Br)c1OC1=C(Oc2c(Br)cccc2Br)CCC1 |
| InChI | InChI=1S/C17H12Br4O2/c18-10-4-1-5-11(19)16(10)22-14-8-3-9-15(14)23-17-12(20)6-2-7-13(17)21/h1-2,4-7H,3,8-9H2 |
| InChIKey | XQCICPHRWXIQSG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene?
The IUPAC name of 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene (CID 54482640) is 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene.
What is the SMILES notation for 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene?
The canonical SMILES for 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene is Brc1cccc(Br)c1OC1=C(Oc2c(Br)cccc2Br)CCC1.
What is the InChIKey of 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene?
The InChIKey is XQCICPHRWXIQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Br4O2/c18-10-4-1-5-11(19)16(10)22-14-8-3-9-15(14)23-17-12(20)6-2-7-13(17)21/h1-2,4-7H,3,8-9H2.
What are the key properties of 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene?
1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene has a molecular weight of 567.90 g/mol, XLogP of 7.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-2-[2-(2,6-dibromophenoxy)cyclopenten-1-yl]oxybenzene is sourced from PubChem (CID 54482640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).