C14H15F — CID 173366752
2-fluoro-1,3-dimethyl-4-phenylcyclohexa-1,3-diene (PubChem CID 173366752) has the molecular formula C14H15F and a molecular weight of 202.27 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethyl-4-phenylcyclohexa-1,3-diene.
| Compound Name | 2-fluoro-1,3-dimethyl-4-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173366752 |
| Molecular Formula | C14H15F |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-fluoro-1,3-dimethyl-4-phenylcyclohexa-1,3-diene |
| SMILES | CC1=C(F)C(C)=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H15F/c1-10-8-9-13(11(2)14(10)15)12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3 |
| InChIKey | ODGUCVIKKVKVAB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |