C14H16 — CID 90955588
1,4-dimethyl-2-phenylcyclohexa-1,3-diene (PubChem CID 90955588) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,4-dimethyl-2-phenylcyclohexa-1,3-diene.
| Compound Name | 1,4-dimethyl-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90955588 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1,4-dimethyl-2-phenylcyclohexa-1,3-diene |
| SMILES | CC1=CC(c2ccccc2)=C(C)CC1 |
| InChI | InChI=1S/C14H16/c1-11-8-9-12(2)14(10-11)13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | ONYBDOUOMBEJDI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |