C12H11Zr- — CID 154195441
(3-methylcyclopenta-1,3-dien-1-yl)benzene;zirconium (PubChem CID 154195441) has the molecular formula C12H11Zr- and a molecular weight of 246.44 g/mol. Its IUPAC name is (3-methylcyclopenta-1,3-dien-1-yl)benzene;zirconium.
| Compound Name | (3-methylcyclopenta-1,3-dien-1-yl)benzene;zirconium |
|---|---|
| PubChem CID | 154195441 |
| Molecular Formula | C12H11Zr- |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | (3-methylcyclopenta-1,3-dien-1-yl)benzene;zirconium |
| SMILES | CC1=[C-]CC(c2ccccc2)=C1.[Zr] |
| InChI | InChI=1S/C12H11.Zr/c1-10-7-8-12(9-10)11-5-3-2-4-6-11;/h2-6,9H,8H2,1H3;/q-1; |
| InChIKey | VYAIIIKZKPXJTJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|