C37H30O3 — CID 174520106
Bis(2,3,4,5-tetrahydrochrysen-1-yl) carbonate (PubChem CID 174520106) has the molecular formula C37H30O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is bis(2,3,4,5-tetrahydrochrysen-1-yl) carbonate.
| Compound Name | Bis(2,3,4,5-tetrahydrochrysen-1-yl) carbonate |
|---|---|
| PubChem CID | 174520106 |
| Molecular Formula | C37H30O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | bis(2,3,4,5-tetrahydrochrysen-1-yl) carbonate |
| SMILES | C1CC2=C3CC=C4C=CC=CC4=C3C=CC2=C(C1)OC(=O)OC5=C6C=CC7=C8C=CC=CC8=CCC7=C6CCC5 |
| InChI | InChI=1S/C37H30O3/c38-37(39-35-13-5-11-27-31-17-15-23-7-1-3-9-25(23)29(31)19-21-33(27)35)40-36-14-6-12-28-32-18-16-24-8-2-4-10-26(24)30(32)20-22-34(28)36/h1-4,7-10,15-16,19-22H,5-6,11-14,17-18H2 |
| InChIKey | ZZINGBBKPYEARN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | 1590 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |