C18H14O2 — CID 174891362
1-hydroxy-4,5-dihydro-3H-chrysen-2-one (PubChem CID 174891362) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-hydroxy-4,5-dihydro-3H-chrysen-2-one.
| Compound Name | 1-hydroxy-4,5-dihydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 174891362 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-hydroxy-4,5-dihydro-3H-chrysen-2-one |
| SMILES | O=C1CCc2c3c(ccc2=C1O)=c1ccccc1=CC3 |
| InChI | InChI=1S/C18H14O2/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20/h1-5,7-8,20H,6,9-10H2 |
| InChIKey | MQGSHLXNWUMCDG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |