C23H23N — CID 175274731
1,2-dihydropyridine;2,3,4,5-tetrahydrochrysene (PubChem CID 175274731) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 1,2-dihydropyridine;2,3,4,5-tetrahydrochrysene.
| Compound Name | 1,2-dihydropyridine;2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 175274731 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1,2-dihydropyridine;2,3,4,5-tetrahydrochrysene |
| SMILES | C1=CCNC=C1.C1=c2ccc3c(c2CCC1)CC=c1ccccc1=3 |
| InChI | InChI=1S/C18H16.C5H7N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-6-5-3-1/h1,3,5-7,9-10,12H,2,4,8,11H2;1-4,6H,5H2 |
| InChIKey | NZEYLUCXGFQHKR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |