C18H14Cl2 — CID 174698795
8,9-dichloro-2,3,4,5-tetrahydrochrysene (PubChem CID 174698795) has the molecular formula C18H14Cl2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 8,9-dichloro-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8,9-dichloro-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174698795 |
| Molecular Formula | C18H14Cl2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 8,9-dichloro-2,3,4,5-tetrahydrochrysene |
| SMILES | Clc1cc2c(cc1Cl)=c1ccc3c(c1CC=2)CCCC=3 |
| InChI | InChI=1S/C18H14Cl2/c19-17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18(17)20/h3,5-7,9-10H,1-2,4,8H2 |
| InChIKey | LNYMALVXWNCTIZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |