C19H16ClF — CID 175252158
8-chloro-7-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene (PubChem CID 175252158) has the molecular formula C19H16ClF and a molecular weight of 298.79 g/mol. Its IUPAC name is 8-chloro-7-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-chloro-7-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 175252158 |
| Molecular Formula | C19H16ClF |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 8-chloro-7-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene |
| SMILES | CC1=c2ccc3c(c2CCC1)CC=c1c(F)c(Cl)ccc1=3 |
| InChI | InChI=1S/C19H16ClF/c1-11-3-2-4-13-12(11)5-6-15-14(13)7-8-17-16(15)9-10-18(20)19(17)21/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | YMWUIDCEVBFLNR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |