C26H20ClNO3 — CID 174314463
(7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)-(2-methyl-4-nitrophenyl)methanone (PubChem CID 174314463) has the molecular formula C26H20ClNO3 and a molecular weight of 429.90 g/mol. Its IUPAC name is (7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)-(2-methyl-4-nitrophenyl)methanone.
| Compound Name | (7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)-(2-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 174314463 |
| Molecular Formula | C26H20ClNO3 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)-(2-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)C1=c2ccc3c(c2CCC1)CC=c1c(Cl)cccc1=3 |
| InChI | InChI=1S/C26H20ClNO3/c1-15-14-16(28(30)31)8-9-17(15)26(29)24-6-2-4-18-20-12-13-23-19(5-3-7-25(23)27)21(20)10-11-22(18)24/h3,5,7-11,13-14H,2,4,6,12H2,1H3 |
| InChIKey | MTMZBYUAPFXZND-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|