C20H18ClF — CID 174532842
8-chloro-1-ethyl-7-fluoro-2,3,4,5-tetrahydrochrysene (PubChem CID 174532842) has the molecular formula C20H18ClF and a molecular weight of 312.82 g/mol. Its IUPAC name is 8-chloro-1-ethyl-7-fluoro-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-chloro-1-ethyl-7-fluoro-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174532842 |
| Molecular Formula | C20H18ClF |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 8-chloro-1-ethyl-7-fluoro-2,3,4,5-tetrahydrochrysene |
| SMILES | CCC1=c2ccc3c(c2CCC1)CC=c1c(F)c(Cl)ccc1=3 |
| InChI | InChI=1S/C20H18ClF/c1-2-12-4-3-5-14-13(12)6-7-16-15(14)8-9-18-17(16)10-11-19(21)20(18)22/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | YARYCGXOSCZCFE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |