C36H31ClN2O — CID 174360514
(4-amino-2-methylphenyl)-(7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)methanone;1H-1-benzazepine (PubChem CID 174360514) has the molecular formula C36H31ClN2O and a molecular weight of 543.11 g/mol. Its IUPAC name is (4-amino-2-methylphenyl)-(7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)methanone;1H-1-benzazepine.
| Compound Name | (4-amino-2-methylphenyl)-(7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)methanone;1H-1-benzazepine |
|---|---|
| PubChem CID | 174360514 |
| Molecular Formula | C36H31ClN2O |
| Molecular Weight | 543.11 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | (4-amino-2-methylphenyl)-(7-chloro-2,3,4,5-tetrahydrochrysen-1-yl)methanone;1H-1-benzazepine |
| SMILES | C1=CNc2ccccc2C=C1.Cc1cc(N)ccc1C(=O)C1=c2ccc3c(c2CCC1)CC=c1c(Cl)cccc1=3 |
| InChI | InChI=1S/C26H22ClNO.C10H9N/c1-15-14-16(28)8-9-17(15)26(29)24-6-2-4-18-20-12-13-23-19(5-3-7-25(23)27)21(20)10-11-22(18)24;1-2-7-10-9(5-1)6-3-4-8-11-10/h3,5,7-11,13-14H,2,4,6,12,28H2,1H3;1-8,11H |
| InChIKey | MNMMXDYURYKOAO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.11 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|