C19H17IO — CID 174532858
2-iodo-7-methyl-8,9,10,11-tetrahydrochrysen-1-ol (PubChem CID 174532858) has the molecular formula C19H17IO and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-iodo-7-methyl-8,9,10,11-tetrahydrochrysen-1-ol.
| Compound Name | 2-iodo-7-methyl-8,9,10,11-tetrahydrochrysen-1-ol |
|---|---|
| PubChem CID | 174532858 |
| Molecular Formula | C19H17IO |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 2-iodo-7-methyl-8,9,10,11-tetrahydrochrysen-1-ol |
| SMILES | CC1=c2ccc3c(c2CCC1)CC=c1c(O)c(I)ccc1=3 |
| InChI | InChI=1S/C19H17IO/c1-11-3-2-4-13-12(11)5-6-15-14(13)7-8-17-16(15)9-10-18(20)19(17)21/h5-6,8-10,21H,2-4,7H2,1H3 |
| InChIKey | YMAOJXJDLIOEAE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|