C7H6I2O — CID 131073470
3,6-diiodo-2-methylphenol (PubChem CID 131073470) has the molecular formula C7H6I2O and a molecular weight of 359.93 g/mol. Its IUPAC name is 3,6-diiodo-2-methylphenol.
| Compound Name | 3,6-diiodo-2-methylphenol |
|---|---|
| PubChem CID | 131073470 |
| Molecular Formula | C7H6I2O |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.85 |
| IUPAC Name | 3,6-diiodo-2-methylphenol |
| SMILES | Cc1c(I)ccc(I)c1O |
| InChI | InChI=1S/C7H6I2O/c1-4-5(8)2-3-6(9)7(4)10/h2-3,10H,1H3 |
| InChIKey | YCBMQXNFKDWGRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|