C17H18I2 — CID 163209653
1-iodo-4-[(4-iodo-2,3-dimethylphenyl)methyl]-2,3-dimethylbenzene (PubChem CID 163209653) has the molecular formula C17H18I2 and a molecular weight of 476.14 g/mol. Its IUPAC name is 1-iodo-4-[(4-iodo-2,3-dimethylphenyl)methyl]-2,3-dimethylbenzene.
| Compound Name | 1-iodo-4-[(4-iodo-2,3-dimethylphenyl)methyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 163209653 |
| Molecular Formula | C17H18I2 |
| Molecular Weight | 476.14 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 1-iodo-4-[(4-iodo-2,3-dimethylphenyl)methyl]-2,3-dimethylbenzene |
| SMILES | Cc1c(I)ccc(Cc2ccc(I)c(C)c2C)c1C |
| InChI | InChI=1S/C17H18I2/c1-10-12(3)16(18)7-5-14(10)9-15-6-8-17(19)13(4)11(15)2/h5-8H,9H2,1-4H3 |
| InChIKey | QEMKOORFHYUIMY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.14 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|