C8H9IS — CID 91874812
3-iodo-2,6-dimethylbenzenethiol (PubChem CID 91874812) has the molecular formula C8H9IS and a molecular weight of 264.13 g/mol. Its IUPAC name is 3-iodo-2,6-dimethylbenzenethiol.
| Compound Name | 3-iodo-2,6-dimethylbenzenethiol |
|---|---|
| PubChem CID | 91874812 |
| Molecular Formula | C8H9IS |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | 3-iodo-2,6-dimethylbenzenethiol |
| SMILES | Cc1ccc(I)c(C)c1S |
| InChI | InChI=1S/C8H9IS/c1-5-3-4-7(9)6(2)8(5)10/h3-4,10H,1-2H3 |
| InChIKey | AXUJPUGIRYRTEC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|