About 1-iodo-4,5,8-trimethylnaphthalene
1-iodo-4,5,8-trimethylnaphthalene (PubChem CID 134559851) has the molecular formula C13H13I
and a molecular weight of 296.15 g/mol. Its IUPAC name is 1-iodo-4,5,8-trimethylnaphthalene.
Molecular Properties
| Compound Name | 1-iodo-4,5,8-trimethylnaphthalene |
| PubChem CID | 134559851 |
| Molecular Formula | C13H13I |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1-iodo-4,5,8-trimethylnaphthalene |
| SMILES | Cc1ccc(C)c2c(I)ccc(C)c12 |
| InChI | InChI=1S/C13H13I/c1-8-4-5-10(3)13-11(14)7-6-9(2)12(8)13/h4-7H,1-3H3 |
| InChIKey | APNQZNCCFSUUHX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4,5,8-trimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4,5,8-trimethylnaphthalene?
The IUPAC name of 1-iodo-4,5,8-trimethylnaphthalene (CID 134559851) is 1-iodo-4,5,8-trimethylnaphthalene.
What is the SMILES notation for 1-iodo-4,5,8-trimethylnaphthalene?
The canonical SMILES for 1-iodo-4,5,8-trimethylnaphthalene is Cc1ccc(C)c2c(I)ccc(C)c12.
What is the InChIKey of 1-iodo-4,5,8-trimethylnaphthalene?
The InChIKey is APNQZNCCFSUUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13I/c1-8-4-5-10(3)13-11(14)7-6-9(2)12(8)13/h4-7H,1-3H3.
What are the key properties of 1-iodo-4,5,8-trimethylnaphthalene?
1-iodo-4,5,8-trimethylnaphthalene has a molecular weight of 296.15 g/mol, XLogP of 4.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4,5,8-trimethylnaphthalene is sourced from PubChem (CID 134559851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).