About 3-fluoro-1,2-diiodo-4-methylbenzene
3-fluoro-1,2-diiodo-4-methylbenzene (PubChem CID 130967572) has the molecular formula C7H5FI2
and a molecular weight of 361.92 g/mol. Its IUPAC name is 3-fluoro-1,2-diiodo-4-methylbenzene.
Molecular Properties
| Compound Name | 3-fluoro-1,2-diiodo-4-methylbenzene |
| PubChem CID | 130967572 |
| Molecular Formula | C7H5FI2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | 3-fluoro-1,2-diiodo-4-methylbenzene |
| SMILES | Cc1ccc(I)c(I)c1F |
| InChI | InChI=1S/C7H5FI2/c1-4-2-3-5(9)7(10)6(4)8/h2-3H,1H3 |
| InChIKey | VPOCPSHVIPFCKP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-1,2-diiodo-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,2-diiodo-4-methylbenzene?
The IUPAC name of 3-fluoro-1,2-diiodo-4-methylbenzene (CID 130967572) is 3-fluoro-1,2-diiodo-4-methylbenzene.
What is the SMILES notation for 3-fluoro-1,2-diiodo-4-methylbenzene?
The canonical SMILES for 3-fluoro-1,2-diiodo-4-methylbenzene is Cc1ccc(I)c(I)c1F.
What is the InChIKey of 3-fluoro-1,2-diiodo-4-methylbenzene?
The InChIKey is VPOCPSHVIPFCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FI2/c1-4-2-3-5(9)7(10)6(4)8/h2-3H,1H3.
What are the key properties of 3-fluoro-1,2-diiodo-4-methylbenzene?
3-fluoro-1,2-diiodo-4-methylbenzene has a molecular weight of 361.92 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,2-diiodo-4-methylbenzene is sourced from PubChem (CID 130967572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).