About 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene
1-(chloromethyl)-2-fluoro-3,4-diiodobenzene (PubChem CID 130882439) has the molecular formula C7H4ClFI2
and a molecular weight of 396.37 g/mol. Its IUPAC name is 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene.
Molecular Properties
| Compound Name | 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene |
| PubChem CID | 130882439 |
| Molecular Formula | C7H4ClFI2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.81 |
| IUPAC Name | 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene |
| SMILES | Fc1c(CCl)ccc(I)c1I |
| InChI | InChI=1S/C7H4ClFI2/c8-3-4-1-2-5(10)7(11)6(4)9/h1-2H,3H2 |
| InChIKey | ULPFLOBLLWOQSL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene?
The IUPAC name of 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene (CID 130882439) is 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene.
What is the SMILES notation for 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene?
The canonical SMILES for 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene is Fc1c(CCl)ccc(I)c1I.
What is the InChIKey of 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene?
The InChIKey is ULPFLOBLLWOQSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClFI2/c8-3-4-1-2-5(10)7(11)6(4)9/h1-2H,3H2.
What are the key properties of 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene?
1-(chloromethyl)-2-fluoro-3,4-diiodobenzene has a molecular weight of 396.37 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-2-fluoro-3,4-diiodobenzene is sourced from PubChem (CID 130882439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).