C8H7Cl2I — CID 134821742
1,4-bis(chloromethyl)-2-iodobenzene (PubChem CID 134821742) has the molecular formula C8H7Cl2I and a molecular weight of 300.95 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2-iodobenzene.
| Compound Name | 1,4-bis(chloromethyl)-2-iodobenzene |
|---|---|
| PubChem CID | 134821742 |
| Molecular Formula | C8H7Cl2I |
| Molecular Weight | 300.95 g/mol |
| Exact Mass | 299.90 |
| IUPAC Name | 1,4-bis(chloromethyl)-2-iodobenzene |
| SMILES | ClCc1ccc(CCl)c(I)c1 |
| InChI | InChI=1S/C8H7Cl2I/c9-4-6-1-2-7(5-10)8(11)3-6/h1-3H,4-5H2 |
| InChIKey | BGNYJLBGIHZLAG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|