C13H18Cl2 — CID 69328876
1,4-bis(chloromethyl)-2-pentylbenzene (PubChem CID 69328876) has the molecular formula C13H18Cl2 and a molecular weight of 245.19 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2-pentylbenzene.
| Compound Name | 1,4-bis(chloromethyl)-2-pentylbenzene |
|---|---|
| PubChem CID | 69328876 |
| Molecular Formula | C13H18Cl2 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1,4-bis(chloromethyl)-2-pentylbenzene |
| SMILES | CCCCCc1cc(CCl)ccc1CCl |
| InChI | InChI=1S/C13H18Cl2/c1-2-3-4-5-12-8-11(9-14)6-7-13(12)10-15/h6-8H,2-5,9-10H2,1H3 |
| InChIKey | HQYVIMMWWNJVJD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|