C8H7Cl2F — CID 165357761
2,4-bis(chloromethyl)-1-fluorobenzene (PubChem CID 165357761) has the molecular formula C8H7Cl2F and a molecular weight of 193.05 g/mol. Its IUPAC name is 2,4-bis(chloromethyl)-1-fluorobenzene.
| Compound Name | 2,4-bis(chloromethyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 165357761 |
| Molecular Formula | C8H7Cl2F |
| Molecular Weight | 193.05 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | 2,4-bis(chloromethyl)-1-fluorobenzene |
| SMILES | Fc1ccc(CCl)cc1CCl |
| InChI | InChI=1S/C8H7Cl2F/c9-4-6-1-2-8(11)7(3-6)5-10/h1-3H,4-5H2 |
| InChIKey | DGZBPHRQRKYFMC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.05 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|