C9H7Cl2NO — CID 57206298
2,4-bis(chloromethyl)-1-isocyanatobenzene (PubChem CID 57206298) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is 2,4-bis(chloromethyl)-1-isocyanatobenzene.
| Compound Name | 2,4-bis(chloromethyl)-1-isocyanatobenzene |
|---|---|
| PubChem CID | 57206298 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2,4-bis(chloromethyl)-1-isocyanatobenzene |
| SMILES | O=C=Nc1ccc(CCl)cc1CCl |
| InChI | InChI=1S/C9H7Cl2NO/c10-4-7-1-2-9(12-6-13)8(3-7)5-11/h1-3H,4-5H2 |
| InChIKey | QOJPICUXNOSWCU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|