C7HCl2F2NO — CID 169352506
2,4-dichloro-1,3-difluoro-5-isocyanatobenzene (PubChem CID 169352506) has the molecular formula C7HCl2F2NO and a molecular weight of 223.99 g/mol. Its IUPAC name is 2,4-dichloro-1,3-difluoro-5-isocyanatobenzene.
| Compound Name | 2,4-dichloro-1,3-difluoro-5-isocyanatobenzene |
|---|---|
| PubChem CID | 169352506 |
| Molecular Formula | C7HCl2F2NO |
| Molecular Weight | 223.99 g/mol |
| Exact Mass | 222.94 |
| IUPAC Name | 2,4-dichloro-1,3-difluoro-5-isocyanatobenzene |
| SMILES | O=C=Nc1cc(F)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C7HCl2F2NO/c8-5-3(10)1-4(12-2-13)6(9)7(5)11/h1H |
| InChIKey | BNUSGCLQCJEHJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.99 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|