C12H9ClF3NO — CID 117441273
2-chloro-1,3,5-trifluoro-4-(1-isocyanatocyclopentyl)benzene (PubChem CID 117441273) has the molecular formula C12H9ClF3NO and a molecular weight of 275.66 g/mol. Its IUPAC name is 2-chloro-1,3,5-trifluoro-4-(1-isocyanatocyclopentyl)benzene.
| Compound Name | 2-chloro-1,3,5-trifluoro-4-(1-isocyanatocyclopentyl)benzene |
|---|---|
| PubChem CID | 117441273 |
| Molecular Formula | C12H9ClF3NO |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-chloro-1,3,5-trifluoro-4-(1-isocyanatocyclopentyl)benzene |
| SMILES | O=C=NC1(c2c(F)cc(F)c(Cl)c2F)CCCC1 |
| InChI | InChI=1S/C12H9ClF3NO/c13-10-8(15)5-7(14)9(11(10)16)12(17-6-18)3-1-2-4-12/h5H,1-4H2 |
| InChIKey | CRSJLJCYCALPLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|