C11H6ClF4NO — CID 117113114
1-chloro-2,3,5,6-tetrafluoro-4-(1-isocyanatocyclobutyl)benzene (PubChem CID 117113114) has the molecular formula C11H6ClF4NO and a molecular weight of 279.62 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetrafluoro-4-(1-isocyanatocyclobutyl)benzene.
| Compound Name | 1-chloro-2,3,5,6-tetrafluoro-4-(1-isocyanatocyclobutyl)benzene |
|---|---|
| PubChem CID | 117113114 |
| Molecular Formula | C11H6ClF4NO |
| Molecular Weight | 279.62 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 1-chloro-2,3,5,6-tetrafluoro-4-(1-isocyanatocyclobutyl)benzene |
| SMILES | O=C=NC1(c2c(F)c(F)c(Cl)c(F)c2F)CCC1 |
| InChI | InChI=1S/C11H6ClF4NO/c12-6-9(15)7(13)5(8(14)10(6)16)11(17-4-18)2-1-3-11/h1-3H2 |
| InChIKey | QKQKEGPMWWIPRN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|